CAS 2237-14-1 appears in our catalog under these names: p-Benzoquinone-d4, >95% (HPLC), 1,4-Benzoquinone-d4, 98 atom % D, min 98% Chemical Purity, 1,4-BENZOQUINONE-D4, 98 ATOM % D. Offered by: TRC, CDN, Sigma-Aldrich. Available pack sizes: 100mg, 0,5g, 0,25g, 500MG.
2,3,5,6-tetradeuteriocyclohexa-2,5-diene-1,4-dione (CAS 2237-14-1) is a chemical compound with the molecular formula C6H4O2 and a molecular weight of 112.12 g/mol. IUPAC name: 2,3,5,6-tetradeuteriocyclohexa-2,5-diene-1,4-dione. InChIKey: AZQWKYJCGOJGHM-RHQRLBAQSA-N.
| Molecular formula | C6H4O2 |
|---|---|
| Molecular weight | 112.12 g/mol |
| IUPAC name | 2,3,5,6-tetradeuteriocyclohexa-2,5-diene-1,4-dione |
| InChIKey | AZQWKYJCGOJGHM-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=O)C(=C(C1=O)[2H])[2H])[2H] |
Computed by PubChem (NCBI)