CAS 2237221-72-4 is the registry number for 2-(3,5,7-Trifluoroadamantan-1-yl)acetic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2-(3,5,7-trifluoro-1-adamantyl)acetic acid (CAS 2237221-72-4) is a chemical compound with the molecular formula C12H15F3O2 and a molecular weight of 248.24 g/mol. IUPAC name: 2-(3,5,7-trifluoro-1-adamantyl)acetic acid. InChIKey: ANVXICZMNVEJFE-UHFFFAOYSA-N.
| Molecular formula | C12H15F3O2 |
|---|---|
| Molecular weight | 248.24 g/mol |
| IUPAC name | 2-(3,5,7-trifluoro-1-adamantyl)acetic acid |
| InChIKey | ANVXICZMNVEJFE-UHFFFAOYSA-N |
| SMILES | C1C2(CC3(CC1(CC(C2)(C3)F)F)F)CC(=O)O |
Computed by PubChem (NCBI)