Products 2237228-68-9
CAS 2237228-68-9 is the registry number for 5,5'-(Ethane-1,2-diylbis(azanediyl))diisophthalic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[2-(3,5-dicarboxyanilino)ethylamino]benzene-1,3-dicarboxylic acid (CAS 2237228-68-9) is a chemical compound with the molecular formula C18H16N2O8 and a molecular weight of 388.3 g/mol. IUPAC name: 5-[2-(3,5-dicarboxyanilino)ethylamino]benzene-1,3-dicarboxylic acid. InChIKey: OHDMABNQSURJDT-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O8 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | 5-[2-(3,5-dicarboxyanilino)ethylamino]benzene-1,3-dicarboxylic acid |
| InChIKey | OHDMABNQSURJDT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)NCCNC2=CC(=CC(=C2)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)