Products 2237267-86-4
CAS 2237267-86-4 is the registry number for NAMPT activator-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(4-piperazin-1-ylsulfonylphenyl)-3-(pyridin-4-ylmethyl)urea (CAS 2237267-86-4) is a chemical compound with the molecular formula C17H21N5O3S and a molecular weight of 375.4 g/mol. IUPAC name: 1-(4-piperazin-1-ylsulfonylphenyl)-3-(pyridin-4-ylmethyl)urea. InChIKey: UJLNVXGRVQYDKI-UHFFFAOYSA-N.
| Molecular formula | C17H21N5O3S |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 1-(4-piperazin-1-ylsulfonylphenyl)-3-(pyridin-4-ylmethyl)urea |
| InChIKey | UJLNVXGRVQYDKI-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CC=C(C=C2)NC(=O)NCC3=CC=NC=C3 |
Computed by PubChem (NCBI)