CAS 223762-21-8 appears in our catalog under these names: 3-Methyl-1-(morpholin-4-ylcarbonyl)-1h-imidazol-3-ium iodide, 95%, 3-Methyl-1-(morpholine-4-carbonyl)-1h-imidazol-3-ium iodide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(3-methylimidazol-3-ium-1-yl)-morpholin-4-ylmethanone iodide (CAS 223762-21-8) is a chemical compound with the molecular formula C9H14IN3O2 and a molecular weight of 323.13 g/mol. IUPAC name: (3-methylimidazol-3-ium-1-yl)-morpholin-4-ylmethanone iodide. InChIKey: VYQYJJLRFOBIIF-UHFFFAOYSA-M.
| Molecular formula | C9H14IN3O2 |
|---|---|
| Molecular weight | 323.13 g/mol |
| IUPAC name | (3-methylimidazol-3-ium-1-yl)-morpholin-4-ylmethanone iodide |
| InChIKey | VYQYJJLRFOBIIF-UHFFFAOYSA-M |
| SMILES | C[N+]1=CN(C=C1)C(=O)N2CCOCC2.[I-] |
Computed by PubChem (NCBI)