Products 223763-80-2
CAS 223763-80-2 appears in our catalog under these names: Bestatin trifluoroacetate, Bestatin (trifluoroacetate). Offered by: TargetMol, Biosynth, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 10mg, 5mg.
(2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid;2,2,2-trifluoroacetic acid (CAS 223763-80-2) is a chemical compound with the molecular formula C18H25F3N2O6 and a molecular weight of 422.4 g/mol. IUPAC name: (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid;2,2,2-trifluoroacetic acid. InChIKey: UOALAMWBTXFYPB-UDYGKFQRSA-N.
| Molecular formula | C18H25F3N2O6 |
|---|---|
| Molecular weight | 422.4 g/mol |
| IUPAC name | (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid;2,2,2-trifluoroacetic acid |
| InChIKey | UOALAMWBTXFYPB-UDYGKFQRSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H]([C@@H](CC1=CC=CC=C1)N)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)