CAS 223769-64-0 appears in our catalog under these names: Hydroxystilbamidine bis(fluoroGlod), 98%, Hydroxystilbamidine bis(methanesulfonate), Hydroxystilbamidine bis(methanesulfonate), Hydroxystilbamidine bis(fluoroGlod) 98%, HYDROXYSTILBAMIDINE BIS(METHANESULFONAT&. Offered by: AmBeed, TargetMol, GLPBio, Chemat, Sigma-Aldrich. Available pack sizes: 1mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg, 10 mg.
4-[(E)-2-(4-carbamimidoylphenyl)ethenyl]-3-hydroxybenzenecarboximidamide;methanesulfonic acid (CAS 223769-64-0) is a chemical compound with the molecular formula C18H24N4O7S2 and a molecular weight of 472.5 g/mol. IUPAC name: 4-[(E)-2-(4-carbamimidoylphenyl)ethenyl]-3-hydroxybenzenecarboximidamide;methanesulfonic acid. InChIKey: YGNSQKCULHSJDC-HFPMQDOPSA-N.
| Molecular formula | C18H24N4O7S2 |
|---|---|
| Molecular weight | 472.5 g/mol |
| IUPAC name | 4-[(E)-2-(4-carbamimidoylphenyl)ethenyl]-3-hydroxybenzenecarboximidamide;methanesulfonic acid |
| InChIKey | YGNSQKCULHSJDC-HFPMQDOPSA-N |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.C1=CC(=CC=C1/C=C/C2=C(C=C(C=C2)C(=N)N)O)C(=N)N |
Computed by PubChem (NCBI)