CAS 223785-76-0 appears in our catalog under these names: 1–(2,6–Dichloro–3–nitrophenyl)ethanone, 1-(2,6-Dichloro-3-nitrophenyl)ethanone 95%, 1-(2,6-Dichloro-3-nitrophenyl)ethanone, 97%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(2,6-dichloro-3-nitrophenyl)ethanone (CAS 223785-76-0) is a chemical compound with the molecular formula C8H5Cl2NO3 and a molecular weight of 234.03 g/mol. IUPAC name: 1-(2,6-dichloro-3-nitrophenyl)ethanone. InChIKey: NAMVLFOWONWZFY-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO3 |
|---|---|
| Molecular weight | 234.03 g/mol |
| IUPAC name | 1-(2,6-dichloro-3-nitrophenyl)ethanone |
| InChIKey | NAMVLFOWONWZFY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)