Products 2237913-44-7
CAS 2237913-44-7 is the registry number for Ethyl 2-(2-benzhydryl-1H-indol-3-yl)-2-ethoxy-2-(4-nitrophenyl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(2-benzhydryl-1H-indol-3-yl)-2-ethoxy-2-(4-nitrophenyl)acetate (CAS 2237913-44-7) is a chemical compound with the molecular formula C33H30N2O5 and a molecular weight of 534.6 g/mol. IUPAC name: ethyl 2-(2-benzhydryl-1H-indol-3-yl)-2-ethoxy-2-(4-nitrophenyl)acetate. InChIKey: NKXHGBGKNOFGJQ-UHFFFAOYSA-N.
| Molecular formula | C33H30N2O5 |
|---|---|
| Molecular weight | 534.6 g/mol |
| IUPAC name | ethyl 2-(2-benzhydryl-1H-indol-3-yl)-2-ethoxy-2-(4-nitrophenyl)acetate |
| InChIKey | NKXHGBGKNOFGJQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=C(C=C1)[N+](=O)[O-])(C2=C(NC3=CC=CC=C32)C(C4=CC=CC=C4)C5=CC=CC=C5)OCC |
Computed by PubChem (NCBI)