CAS 2237925-62-9 appears in our catalog under these names: DMA-135 hydrochloride/ 98.21% (existing batch purity), DMA–135 hydrochloride, DMA-135 (hydrochloride), 98.04% ,, 98.04% ,, DMA-135 (hydrochloride), 99.58%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 50 mg, 10 mg, 5 mg, 25 mg.
3-amino-N-(diaminomethylidene)-5-(dimethylamino)-6-(2-phenylethynyl)pyrazine-2-carboxamide;hydrochloride (CAS 2237925-62-9) is a chemical compound with the molecular formula C16H18ClN7O and a molecular weight of 359.8 g/mol. IUPAC name: 3-amino-N-(diaminomethylidene)-5-(dimethylamino)-6-(2-phenylethynyl)pyrazine-2-carboxamide;hydrochloride. InChIKey: RBMSZKWMVJWPEP-UHFFFAOYSA-N.
| Molecular formula | C16H18ClN7O |
|---|---|
| Molecular weight | 359.8 g/mol |
| IUPAC name | 3-amino-N-(diaminomethylidene)-5-(dimethylamino)-6-(2-phenylethynyl)pyrazine-2-carboxamide;hydrochloride |
| InChIKey | RBMSZKWMVJWPEP-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(N=C(C(=N1)N)C(=O)N=C(N)N)C#CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)