Products 2238839-34-2
CAS 2238839-34-2 is the registry number for FKK6, 99.14%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg.
1-[1-(benzenesulfonyl)indol-2-yl]-1-pyridin-4-ylbut-3-yn-1-ol (CAS 2238839-34-2) is a chemical compound with the molecular formula C23H18N2O3S and a molecular weight of 402.5 g/mol. IUPAC name: 1-[1-(benzenesulfonyl)indol-2-yl]-1-pyridin-4-ylbut-3-yn-1-ol. InChIKey: VOFKHNAVOAQCBE-UHFFFAOYSA-N.
| Molecular formula | C23H18N2O3S |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | 1-[1-(benzenesulfonyl)indol-2-yl]-1-pyridin-4-ylbut-3-yn-1-ol |
| InChIKey | VOFKHNAVOAQCBE-UHFFFAOYSA-N |
| SMILES | C#CCC(C1=CC=NC=C1)(C2=CC3=CC=CC=C3N2S(=O)(=O)C4=CC=CC=C4)O |
Computed by PubChem (NCBI)