Products 2238852-59-8
CAS 2238852-59-8 is the registry number for STAADIUMâ„¢ PeptiZide L-Ala. Offered by: Biosynth. Available pack sizes: 1g, 2,5g.
[(2S)-1-[4-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]anilino]-1-oxopropan-2-yl]azanium chloride (CAS 2238852-59-8) is a chemical compound with the molecular formula C15H18ClN3O2S and a molecular weight of 339.8 g/mol. IUPAC name: [(2S)-1-[4-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]anilino]-1-oxopropan-2-yl]azanium chloride. InChIKey: UIQSYTGEHJJCOD-MERQFXBCSA-N.
| Molecular formula | C15H18ClN3O2S |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | [(2S)-1-[4-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]anilino]-1-oxopropan-2-yl]azanium chloride |
| InChIKey | UIQSYTGEHJJCOD-MERQFXBCSA-N |
| SMILES | C[C@@H](C(=O)NC1=CC=C(C=C1)CSC2=CC=CC=[N+]2[O-])[NH3+].[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
STAADIUMtrade mark PeptiZide L-Ala