CAS 22393-63-1 appears in our catalog under these names: 22393-62-0_peak 2/ 98.71% (existing batch purity), (Z)-1-Bromo-1,2-diphenyl-2-(p-ethylphenyl)ethene. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg.
1-[(Z)-2-bromo-1,2-diphenylethenyl]-4-ethylbenzene (CAS 22393-63-1) is a chemical compound with the molecular formula C22H19Br and a molecular weight of 363.3 g/mol. IUPAC name: 1-[(Z)-2-bromo-1,2-diphenylethenyl]-4-ethylbenzene. InChIKey: OQCYTSHIQNPJIC-DQRAZIAOSA-N.
| Molecular formula | C22H19Br |
|---|---|
| Molecular weight | 363.3 g/mol |
| IUPAC name | 1-[(Z)-2-bromo-1,2-diphenylethenyl]-4-ethylbenzene |
| InChIKey | OQCYTSHIQNPJIC-DQRAZIAOSA-N |
| SMILES | CCC1=CC=C(C=C1)/C(=C(/C2=CC=CC=C2)\Br)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)