CAS 2241127-85-3 is the registry number for Lithium 1-methyl-2,3-dihydro-1H-indole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Lithium 1-methyl-2,3-dihydroindole-2-carboxylate (CAS 2241127-85-3) is a chemical compound with the molecular formula C10H10LiNO2 and a molecular weight of 183.2 g/mol. IUPAC name: lithium 1-methyl-2,3-dihydroindole-2-carboxylate. InChIKey: JYEQPRZBNFSGEE-UHFFFAOYSA-M.
| Molecular formula | C10H10LiNO2 |
|---|---|
| Molecular weight | 183.2 g/mol |
| IUPAC name | lithium 1-methyl-2,3-dihydroindole-2-carboxylate |
| InChIKey | JYEQPRZBNFSGEE-UHFFFAOYSA-M |
| SMILES | [Li+].CN1C(CC2=CC=CC=C21)C(=O)[O-] |
Computed by PubChem (NCBI)