Products 2241130-01-6
CAS 2241130-01-6 is the registry number for 2-((4-Methyl-1,3-thiazol-2-yl)methyl)-2,3-dihydro-1H-isoindole-1,3-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-[(4-methyl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrochloride (CAS 2241130-01-6) is a chemical compound with the molecular formula C13H11ClN2O2S and a molecular weight of 294.76 g/mol. IUPAC name: 2-[(4-methyl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrochloride. InChIKey: GSHYAZBZAMFWFD-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O2S |
|---|---|
| Molecular weight | 294.76 g/mol |
| IUPAC name | 2-[(4-methyl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrochloride |
| InChIKey | GSHYAZBZAMFWFD-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)CN2C(=O)C3=CC=CC=C3C2=O.Cl |
Computed by PubChem (NCBI)