CAS 2241131-07-5 is the registry number for 1-(5-(Thiophen-2-yl)-1H-1,2,4-triazol-3-yl)cyclobutan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-amine;hydrochloride (CAS 2241131-07-5) is a chemical compound with the molecular formula C10H13ClN4S and a molecular weight of 256.76 g/mol. IUPAC name: 1-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-amine;hydrochloride. InChIKey: HZBDGLDKBWEDFZ-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN4S |
|---|---|
| Molecular weight | 256.76 g/mol |
| IUPAC name | 1-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-amine;hydrochloride |
| InChIKey | HZBDGLDKBWEDFZ-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=NC(=NN2)C3=CC=CS3)N.Cl |
Computed by PubChem (NCBI)