CAS 2241138-83-8 is the registry number for 5-(1-Methyl-1H-pyrazol-5-yl)-1H-1,2,3-triazol-4-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(2-methylpyrazol-3-yl)-2H-triazol-4-amine;hydrochloride (CAS 2241138-83-8) is a chemical compound with the molecular formula C6H9ClN6 and a molecular weight of 200.63 g/mol. IUPAC name: 5-(2-methylpyrazol-3-yl)-2H-triazol-4-amine;hydrochloride. InChIKey: BLDFMIMZHGLGPJ-UHFFFAOYSA-N.
| Molecular formula | C6H9ClN6 |
|---|---|
| Molecular weight | 200.63 g/mol |
| IUPAC name | 5-(2-methylpyrazol-3-yl)-2H-triazol-4-amine;hydrochloride |
| InChIKey | BLDFMIMZHGLGPJ-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)C2=NNN=C2N.Cl |
Computed by PubChem (NCBI)