CAS 2241139-63-7 is the registry number for tert-Butyl 7-oxo-2,5-diazaspiro(3.4)octane-2-carboxylate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 7-oxo-2,5-diazaspiro[3.4]octane-2-carboxylate;hydrochloride (CAS 2241139-63-7) is a chemical compound with the molecular formula C11H19ClN2O3 and a molecular weight of 262.73 g/mol. IUPAC name: tert-butyl 7-oxo-2,5-diazaspiro[3.4]octane-2-carboxylate;hydrochloride. InChIKey: DNQAYLBZHNTMER-UHFFFAOYSA-N.
| Molecular formula | C11H19ClN2O3 |
|---|---|
| Molecular weight | 262.73 g/mol |
| IUPAC name | tert-butyl 7-oxo-2,5-diazaspiro[3.4]octane-2-carboxylate;hydrochloride |
| InChIKey | DNQAYLBZHNTMER-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(=O)CN2.Cl |
Computed by PubChem (NCBI)