Products 2241139-65-9

CAS 2241139-65-9 is the registry number for Methyl 1,1,3-trioxo-1λâ¶,4-thiazepane-5-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 1,1,3-trioxo-1,4-thiazepane-5-carboxylate (CAS 2241139-65-9) is a chemical compound with the molecular formula C7H11NO5S and a molecular weight of 221.23 g/mol. IUPAC name: methyl 1,1,3-trioxo-1,4-thiazepane-5-carboxylate. InChIKey: QBPKDNBDRJIINB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11NO5S
Molecular weight221.23 g/mol
IUPAC namemethyl 1,1,3-trioxo-1,4-thiazepane-5-carboxylate
InChIKeyQBPKDNBDRJIINB-UHFFFAOYSA-N
SMILESCOC(=O)C1CCS(=O)(=O)CC(=O)N1

Computed by PubChem (NCBI)