CAS 2241139-65-9 is the registry number for Methyl 1,1,3-trioxo-1λâ¶,4-thiazepane-5-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 1,1,3-trioxo-1,4-thiazepane-5-carboxylate (CAS 2241139-65-9) is a chemical compound with the molecular formula C7H11NO5S and a molecular weight of 221.23 g/mol. IUPAC name: methyl 1,1,3-trioxo-1,4-thiazepane-5-carboxylate. InChIKey: QBPKDNBDRJIINB-UHFFFAOYSA-N.
| Molecular formula | C7H11NO5S |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | methyl 1,1,3-trioxo-1,4-thiazepane-5-carboxylate |
| InChIKey | QBPKDNBDRJIINB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCS(=O)(=O)CC(=O)N1 |
Computed by PubChem (NCBI)