CAS 2241140-25-8 is the registry number for 1-{3-Iodo-4H,5H,6H,7H-pyrazolo(1,5-a)pyrazin-5-yl}ethan-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(3-iodo-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)ethanone (CAS 2241140-25-8) is a chemical compound with the molecular formula C8H10IN3O and a molecular weight of 291.09 g/mol. IUPAC name: 1-(3-iodo-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)ethanone. InChIKey: ODOPHILDNOMVLP-UHFFFAOYSA-N.
| Molecular formula | C8H10IN3O |
|---|---|
| Molecular weight | 291.09 g/mol |
| IUPAC name | 1-(3-iodo-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)ethanone |
| InChIKey | ODOPHILDNOMVLP-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCN2C(=C(C=N2)I)C1 |
Computed by PubChem (NCBI)