Products 2241325-66-4
CAS 2241325-66-4 is the registry number for GAK inhibitor 12r. Offered by: GLPBio. Available pack sizes: 10mg.
4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-[1,2]thiazolo[4,3-b]pyridin-6-yl]-2-methoxyaniline (CAS 2241325-66-4) is a chemical compound with the molecular formula C19H22N4O2S and a molecular weight of 370.5 g/mol. IUPAC name: 4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-[1,2]thiazolo[4,3-b]pyridin-6-yl]-2-methoxyaniline. InChIKey: VOFMQYIALBSDFI-TXEJJXNPSA-N.
| Molecular formula | C19H22N4O2S |
|---|---|
| Molecular weight | 370.5 g/mol |
| IUPAC name | 4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-[1,2]thiazolo[4,3-b]pyridin-6-yl]-2-methoxyaniline |
| InChIKey | VOFMQYIALBSDFI-TXEJJXNPSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)C2=C3C(=NS2)C=C(C=N3)C4=CC(=C(C=C4)N)OC |
Computed by PubChem (NCBI)
Synonyms:
GAK inhibitor 12r