CAS 2241400-93-9 appears in our catalog under these names: 6-Bromo-4-methoxypicolinamide, 95%, 6–Bromo–4–methoxypicolinamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
6-bromo-4-methoxypyridine-2-carboxamide (CAS 2241400-93-9) is a chemical compound with the molecular formula C7H7BrN2O2 and a molecular weight of 231.05 g/mol. IUPAC name: 6-bromo-4-methoxypyridine-2-carboxamide. InChIKey: URHIUCSIADNSIA-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O2 |
|---|---|
| Molecular weight | 231.05 g/mol |
| IUPAC name | 6-bromo-4-methoxypyridine-2-carboxamide |
| InChIKey | URHIUCSIADNSIA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NC(=C1)Br)C(=O)N |
Computed by PubChem (NCBI)