Products 2241594-17-0

CAS 2241594-17-0 appears in our catalog under these names: 5-Indolinecarboxaldehyde hydrochloride, 95%, Indoline-5-carbaldehyde hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 500mg.

Structural formula: {0} (CAS {1})

2,3-dihydro-1H-indole-5-carbaldehyde;hydrochloride (CAS 2241594-17-0) is a chemical compound with the molecular formula C9H10ClNO and a molecular weight of 183.63 g/mol. IUPAC name: 2,3-dihydro-1H-indole-5-carbaldehyde;hydrochloride. InChIKey: BNLRDSLXSRASBM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO
Molecular weight183.63 g/mol
IUPAC name2,3-dihydro-1H-indole-5-carbaldehyde;hydrochloride
InChIKeyBNLRDSLXSRASBM-UHFFFAOYSA-N
SMILESC1CNC2=C1C=C(C=C2)C=O.Cl

Computed by PubChem (NCBI)