Products 2241674-94-0
CAS 2241674-94-0 is the registry number for iNOs-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-oxo-3-(2-phenylethyl)-1,3-benzoxazol-4-yl] 5-(dimethylamino)naphthalene-1-sulfonate (CAS 2241674-94-0) is a chemical compound with the molecular formula C27H24N2O5S and a molecular weight of 488.6 g/mol. IUPAC name: [2-oxo-3-(2-phenylethyl)-1,3-benzoxazol-4-yl] 5-(dimethylamino)naphthalene-1-sulfonate. InChIKey: PBGQMSTUSZWGFJ-UHFFFAOYSA-N.
| Molecular formula | C27H24N2O5S |
|---|---|
| Molecular weight | 488.6 g/mol |
| IUPAC name | [2-oxo-3-(2-phenylethyl)-1,3-benzoxazol-4-yl] 5-(dimethylamino)naphthalene-1-sulfonate |
| InChIKey | PBGQMSTUSZWGFJ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)OC3=CC=CC4=C3N(C(=O)O4)CCC5=CC=CC=C5 |
Computed by PubChem (NCBI)
Synonyms:
iNOs-IN-3, orb1686781