Products 2241676-74-2
CAS 2241676-74-2 appears in our catalog under these names: 15-PGDH-IN-1, CAY10795, 15-PGDH-IN-1, 99.70%, CAY10795, 99%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 10mM (in 1ml dmso), 100 mg, 1 mg, 25 mg, 50 mg.
2-methyl-6-[7-(piperidine-1-carbonyl)quinoxalin-2-yl]isoquinolin-1-one (CAS 2241676-74-2) is a chemical compound with the molecular formula C24H22N4O2 and a molecular weight of 398.5 g/mol. IUPAC name: 2-methyl-6-[7-(piperidine-1-carbonyl)quinoxalin-2-yl]isoquinolin-1-one. InChIKey: URHPFANOQLIROT-UHFFFAOYSA-N.
| Molecular formula | C24H22N4O2 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | 2-methyl-6-[7-(piperidine-1-carbonyl)quinoxalin-2-yl]isoquinolin-1-one |
| InChIKey | URHPFANOQLIROT-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C(C1=O)C=CC(=C2)C3=CN=C4C=CC(=CC4=N3)C(=O)N5CCCCC5 |
Computed by PubChem (NCBI)