CAS 224170-09-6 is the registry number for U-101958 (maleate). Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(1-benzylpiperidin-4-yl)-N-methyl-3-propan-2-yloxypyridin-2-amine;(Z)-but-2-enedioic acid (CAS 224170-09-6) is a chemical compound with the molecular formula C25H33N3O5 and a molecular weight of 455.5 g/mol. IUPAC name: N-(1-benzylpiperidin-4-yl)-N-methyl-3-propan-2-yloxypyridin-2-amine;(Z)-but-2-enedioic acid. InChIKey: KPYPLDPMBWPEBO-BTJKTKAUSA-N.
| Molecular formula | C25H33N3O5 |
|---|---|
| Molecular weight | 455.5 g/mol |
| IUPAC name | N-(1-benzylpiperidin-4-yl)-N-methyl-3-propan-2-yloxypyridin-2-amine;(Z)-but-2-enedioic acid |
| InChIKey | KPYPLDPMBWPEBO-BTJKTKAUSA-N |
| SMILES | CC(C)OC1=C(N=CC=C1)N(C)C2CCN(CC2)CC3=CC=CC=C3.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)