Products 2241769-59-3
CAS 2241769-59-3 is the registry number for RORγt agonist 4. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[3,5-dichloro-4-(3-cyano-4-propan-2-yloxyphenyl)phenyl]-2-(4-ethylsulfonylphenyl)acetamide (CAS 2241769-59-3) is a chemical compound with the molecular formula C26H24Cl2N2O4S and a molecular weight of 531.4 g/mol. IUPAC name: N-[3,5-dichloro-4-(3-cyano-4-propan-2-yloxyphenyl)phenyl]-2-(4-ethylsulfonylphenyl)acetamide. InChIKey: FITHLNWDMQDPRR-UHFFFAOYSA-N.
| Molecular formula | C26H24Cl2N2O4S |
|---|---|
| Molecular weight | 531.4 g/mol |
| IUPAC name | N-[3,5-dichloro-4-(3-cyano-4-propan-2-yloxyphenyl)phenyl]-2-(4-ethylsulfonylphenyl)acetamide |
| InChIKey | FITHLNWDMQDPRR-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC=C(C=C1)CC(=O)NC2=CC(=C(C(=C2)Cl)C3=CC(=C(C=C3)OC(C)C)C#N)Cl |
Computed by PubChem (NCBI)
Synonyms:
ROR|At agonist 4, orb2565343