Products 224180-63-6

CAS 224180-63-6 is the registry number for Methyl 2-methyl-1-(propan-2-yl)-1H-pyrrole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2-methyl-1-propan-2-ylpyrrole-3-carboxylate (CAS 224180-63-6) is a chemical compound with the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. IUPAC name: methyl 2-methyl-1-propan-2-ylpyrrole-3-carboxylate. InChIKey: OSEZSJQPDXCYKW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15NO2
Molecular weight181.23 g/mol
IUPAC namemethyl 2-methyl-1-propan-2-ylpyrrole-3-carboxylate
InChIKeyOSEZSJQPDXCYKW-UHFFFAOYSA-N
SMILESCC1=C(C=CN1C(C)C)C(=O)OC

Computed by PubChem (NCBI)