CAS 2241852-82-2 is the registry number for 4,4′-(5,10-Phenazinediyl)bis[benzaldehyde], 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[10-(4-formylphenyl)phenazin-5-yl]benzaldehyde (CAS 2241852-82-2) is a chemical compound with the molecular formula C26H18N2O2 and a molecular weight of 390.4 g/mol. IUPAC name: 4-[10-(4-formylphenyl)phenazin-5-yl]benzaldehyde. InChIKey: LDROWONWXHPRNU-UHFFFAOYSA-N.
| Molecular formula | C26H18N2O2 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 4-[10-(4-formylphenyl)phenazin-5-yl]benzaldehyde |
| InChIKey | LDROWONWXHPRNU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3=CC=CC=C3N2C4=CC=C(C=C4)C=O)C5=CC=C(C=C5)C=O |
Computed by PubChem (NCBI)