Products 2241864-94-6
CAS 2241864-94-6 is the registry number for 6-Bromo-3-pyridinol-d3. Offered by: TRC. Available pack sizes: 100mg.
6-bromo-2,4,5-trideuteriopyridin-3-ol (CAS 2241864-94-6) is a chemical compound with the molecular formula C5H4BrNO and a molecular weight of 177.01 g/mol. IUPAC name: 6-bromo-2,4,5-trideuteriopyridin-3-ol. InChIKey: PTEFNEALEPSHLC-CBYSEHNBSA-N.
| Molecular formula | C5H4BrNO |
|---|---|
| Molecular weight | 177.01 g/mol |
| IUPAC name | 6-bromo-2,4,5-trideuteriopyridin-3-ol |
| InChIKey | PTEFNEALEPSHLC-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1O)[2H])Br)[2H] |
Computed by PubChem (NCBI)