CAS 2241867-27-4 appears in our catalog under these names: 5-(Methoxy-d3)pyridine-3-boronic acid, 96%, (5–(methoxy–d3)pyridin–3–yl)boronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 20mg.
[5-(trideuteriomethoxy)-3-pyridinyl]boronic acid (CAS 2241867-27-4) is a chemical compound with the molecular formula C6H8BNO3 and a molecular weight of 155.96 g/mol. IUPAC name: [5-(trideuteriomethoxy)-3-pyridinyl]boronic acid. InChIKey: ISDFOFZTZUILPE-FIBGUPNXSA-N.
| Molecular formula | C6H8BNO3 |
|---|---|
| Molecular weight | 155.96 g/mol |
| IUPAC name | [5-(trideuteriomethoxy)-3-pyridinyl]boronic acid |
| InChIKey | ISDFOFZTZUILPE-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CN=CC(=C1)B(O)O |
Computed by PubChem (NCBI)