CAS 2241867-45-6 appears in our catalog under these names: 2-(Methoxy-d3)pyrimidine-5-boronic acid, 95%, (2–(methoxy–d3)pyrimidin–5–yl)boronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg, 25mg, 5mg.
[2-(trideuteriomethoxy)pyrimidin-5-yl]boronic acid (CAS 2241867-45-6) is a chemical compound with the molecular formula C5H7BN2O3 and a molecular weight of 156.95 g/mol. IUPAC name: [2-(trideuteriomethoxy)pyrimidin-5-yl]boronic acid. InChIKey: YPWAJLGHACDYQS-FIBGUPNXSA-N.
| Molecular formula | C5H7BN2O3 |
|---|---|
| Molecular weight | 156.95 g/mol |
| IUPAC name | [2-(trideuteriomethoxy)pyrimidin-5-yl]boronic acid |
| InChIKey | YPWAJLGHACDYQS-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=NC=C(C=N1)B(O)O |
Computed by PubChem (NCBI)