CAS 2241870-51-7 appears in our catalog under these names: 3,5-Dibromo-4-methylphenylboronic acid, 95%, (3,5–dibromo–4–(methyl–d3)phenyl)boronic acid, (3,5-dibromo-4-methylphenyl)boronic acid, ≥95%, ≥95%, 3,5-Dibromo-4-methylphenylboronic acid. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 25mg, 5mg.
(3,5-dibromo-4-methylphenyl)boronic acid (CAS 2241870-51-7) is a chemical compound with the molecular formula C7H7BBr2O2 and a molecular weight of 293.75 g/mol. IUPAC name: (3,5-dibromo-4-methylphenyl)boronic acid. InChIKey: NELJHZPSCFFMJR-UHFFFAOYSA-N.
| Molecular formula | C7H7BBr2O2 |
|---|---|
| Molecular weight | 293.75 g/mol |
| IUPAC name | (3,5-dibromo-4-methylphenyl)boronic acid |
| InChIKey | NELJHZPSCFFMJR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Br)C)Br)(O)O |
Computed by PubChem (NCBI)