Products 2241870-51-7

CAS 2241870-51-7 appears in our catalog under these names: 3,5-Dibromo-4-methylphenylboronic acid, 95%, (3,5–dibromo–4–(methyl–d3)phenyl)boronic acid, (3,5-dibromo-4-methylphenyl)boronic acid, ≥95%, ≥95%, 3,5-Dibromo-4-methylphenylboronic acid. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 25mg, 5mg.

Structural formula: {0} (CAS {1})

(3,5-dibromo-4-methylphenyl)boronic acid (CAS 2241870-51-7) is a chemical compound with the molecular formula C7H7BBr2O2 and a molecular weight of 293.75 g/mol. IUPAC name: (3,5-dibromo-4-methylphenyl)boronic acid. InChIKey: NELJHZPSCFFMJR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BBr2O2
Molecular weight293.75 g/mol
IUPAC name(3,5-dibromo-4-methylphenyl)boronic acid
InChIKeyNELJHZPSCFFMJR-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1)Br)C)Br)(O)O

Computed by PubChem (NCBI)