CAS 2241872-06-8 is the registry number for 5–bromo–4–(methyl–d3)–1H–pyrazole–3–d. Offered by: GLPBio. Available pack sizes: 5mg.
5-bromo-3-deuterio-4-(trideuteriomethyl)-1H-pyrazole (CAS 2241872-06-8) is a chemical compound with the molecular formula C4H5BrN2 and a molecular weight of 165.02 g/mol. IUPAC name: 5-bromo-3-deuterio-4-(trideuteriomethyl)-1H-pyrazole. InChIKey: NIKFLRLLYKEJJK-MZCSYVLQSA-N.
| Molecular formula | C4H5BrN2 |
|---|---|
| Molecular weight | 165.02 g/mol |
| IUPAC name | 5-bromo-3-deuterio-4-(trideuteriomethyl)-1H-pyrazole |
| InChIKey | NIKFLRLLYKEJJK-MZCSYVLQSA-N |
| SMILES | [2H]C1=NNC(=C1C([2H])([2H])[2H])Br |
Computed by PubChem (NCBI)