Products 2241872-50-2
CAS 2241872-50-2 is the registry number for 5-Bromopyridin-2(1H)-one-3,4,6-d3. Offered by: TRC. Available pack sizes: 25mg.
5-bromo-3,4,6-trideuterio-1H-pyridin-2-one (CAS 2241872-50-2) is a chemical compound with the molecular formula C5H4BrNO and a molecular weight of 177.01 g/mol. IUPAC name: 5-bromo-3,4,6-trideuterio-1H-pyridin-2-one. InChIKey: NDMZZQRNZFWMEZ-CBYSEHNBSA-N.
| Molecular formula | C5H4BrNO |
|---|---|
| Molecular weight | 177.01 g/mol |
| IUPAC name | 5-bromo-3,4,6-trideuterio-1H-pyridin-2-one |
| InChIKey | NDMZZQRNZFWMEZ-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=O)NC(=C1Br)[2H])[2H] |
Computed by PubChem (NCBI)