CAS 2241875-59-0 is the registry number for (6–(methyl–d3)pyridin–3–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[6-(trideuteriomethyl)-3-pyridinyl]boronic acid (CAS 2241875-59-0) is a chemical compound with the molecular formula C6H8BNO2 and a molecular weight of 139.96 g/mol. IUPAC name: [6-(trideuteriomethyl)-3-pyridinyl]boronic acid. InChIKey: MZUSCPDSQJSBSY-FIBGUPNXSA-N.
| Molecular formula | C6H8BNO2 |
|---|---|
| Molecular weight | 139.96 g/mol |
| IUPAC name | [6-(trideuteriomethyl)-3-pyridinyl]boronic acid |
| InChIKey | MZUSCPDSQJSBSY-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC=C(C=C1)B(O)O |
Computed by PubChem (NCBI)