CAS 2241875-83-0 is the registry number for (2–(piperazin–1–yl–2,2,3,3,5,5,6,6–d8)pyridin–4–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-4-pyridinyl]boronic acid (CAS 2241875-83-0) is a chemical compound with the molecular formula C9H14BN3O2 and a molecular weight of 215.09 g/mol. IUPAC name: [2-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-4-pyridinyl]boronic acid. InChIKey: IEBALFFRORMFKN-SQUIKQQTSA-N.
| Molecular formula | C9H14BN3O2 |
|---|---|
| Molecular weight | 215.09 g/mol |
| IUPAC name | [2-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-4-pyridinyl]boronic acid |
| InChIKey | IEBALFFRORMFKN-SQUIKQQTSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C2=NC=CC(=C2)B(O)O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)