CAS 2241877-04-1 is the registry number for (2–(morpholino–d8)pyrimidin–5–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)pyrimidin-5-yl]boronic acid (CAS 2241877-04-1) is a chemical compound with the molecular formula C8H12BN3O3 and a molecular weight of 217.06 g/mol. IUPAC name: [2-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)pyrimidin-5-yl]boronic acid. InChIKey: KFYQOIHLZBDFBU-SVYQBANQSA-N.
| Molecular formula | C8H12BN3O3 |
|---|---|
| Molecular weight | 217.06 g/mol |
| IUPAC name | [2-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)pyrimidin-5-yl]boronic acid |
| InChIKey | KFYQOIHLZBDFBU-SVYQBANQSA-N |
| SMILES | [2H]C1(C(OC(C(N1C2=NC=C(C=N2)B(O)O)([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)