CAS 2241964-36-1 appears in our catalog under these names: MMP–9–IN–6, MMP-9-IN-6, 98%, MMP-9-IN-6/ 99.75% (existing batch purity), MMP-9-IN-6 98%, MMP-9-IN-6, 99.80%. Offered by: GLPBio, AmBeed, TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 25 mg.
3-(2,5-diphenylfuran-3-yl)-4-methoxy-1H-indole (CAS 2241964-36-1) is a chemical compound with the molecular formula C25H19NO2 and a molecular weight of 365.4 g/mol. IUPAC name: 3-(2,5-diphenylfuran-3-yl)-4-methoxy-1H-indole. InChIKey: YEIMVHHFMFOHPQ-UHFFFAOYSA-N.
| Molecular formula | C25H19NO2 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 3-(2,5-diphenylfuran-3-yl)-4-methoxy-1H-indole |
| InChIKey | YEIMVHHFMFOHPQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=CN2)C3=C(OC(=C3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)