CAS 2241995-91-3 is the registry number for Bis(pivaloyloxy)zinc, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Bis(2,2-dimethylpropanoic acid);zinc (CAS 2241995-91-3) is a chemical compound with the molecular formula C10H20O4Zn and a molecular weight of 269.6 g/mol. IUPAC name: bis(2,2-dimethylpropanoic acid);zinc. InChIKey: ODKPBWFMZPFDKV-UHFFFAOYSA-N.
| Molecular formula | C10H20O4Zn |
|---|---|
| Molecular weight | 269.6 g/mol |
| IUPAC name | bis(2,2-dimethylpropanoic acid);zinc |
| InChIKey | ODKPBWFMZPFDKV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)O.CC(C)(C)C(=O)O.[Zn] |
Computed by PubChem (NCBI)