CAS 22422-69-1 appears in our catalog under these names: 1-(Naphthalen-1-yl)prop-2-en-1-one, 98% +(stabilized with TBC), Bedaquiline Impurity 1, Bedaquiline Fumarate Impurity 6, Bedaquiline Impurity 6. Offered by: AmBeed, Hubei YoungXin, Chemat Brand. Available pack sizes: 250mg, 1g, 10mg, 25mg, 50mg, 100mg, 200mg, on request.
1-naphthalen-1-ylprop-2-en-1-one (CAS 22422-69-1) is a chemical compound with the molecular formula C13H10O and a molecular weight of 182.22 g/mol. IUPAC name: 1-naphthalen-1-ylprop-2-en-1-one. InChIKey: LOWVNVYYWFTFII-UHFFFAOYSA-N.
| Molecular formula | C13H10O |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 1-naphthalen-1-ylprop-2-en-1-one |
| InChIKey | LOWVNVYYWFTFII-UHFFFAOYSA-N |
| SMILES | C=CC(=O)C1=CC=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)