CAS 2242644-66-0 appears in our catalog under these names: 5-(Trifluoromethyl)thiophene-3-boronic acid, 95%, 5-(Trifluoromethyl)thiophene-3-boronic acid, 98%, (5-(Trifluoromethyl)thiophen-3-yl)boronic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 5g, 1g, 10g, 250mg, 0,05g, 0,1g, 0,25g.
[5-(trifluoromethyl)thiophen-3-yl]boronic acid (CAS 2242644-66-0) is a chemical compound with the molecular formula C5H4BF3O2S and a molecular weight of 195.96 g/mol. IUPAC name: [5-(trifluoromethyl)thiophen-3-yl]boronic acid. InChIKey: AUYSWMNWCOLUIV-UHFFFAOYSA-N.
| Molecular formula | C5H4BF3O2S |
|---|---|
| Molecular weight | 195.96 g/mol |
| IUPAC name | [5-(trifluoromethyl)thiophen-3-yl]boronic acid |
| InChIKey | AUYSWMNWCOLUIV-UHFFFAOYSA-N |
| SMILES | B(C1=CSC(=C1)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)