CAS 2242647-55-6 appears in our catalog under these names: Brivaracetam Impurity 16, Brivaracetam Impurity R. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-N-[(2S)-1-amino-1-oxobutan-2-yl]-3-(bromomethyl)hexanamide (CAS 2242647-55-6) is a chemical compound with the molecular formula C11H21BrN2O2 and a molecular weight of 293.20 g/mol. IUPAC name: (3R)-N-[(2S)-1-amino-1-oxobutan-2-yl]-3-(bromomethyl)hexanamide. InChIKey: PCXFNRIBJHZFJF-BDAKNGLRSA-N.
| Molecular formula | C11H21BrN2O2 |
|---|---|
| Molecular weight | 293.20 g/mol |
| IUPAC name | (3R)-N-[(2S)-1-amino-1-oxobutan-2-yl]-3-(bromomethyl)hexanamide |
| InChIKey | PCXFNRIBJHZFJF-BDAKNGLRSA-N |
| SMILES | CCC[C@H](CC(=O)N[C@@H](CC)C(=O)N)CBr |
Computed by PubChem (NCBI)