CAS 2242898-13-9 appears in our catalog under these names: Trifluoromethylthio-iodine(III) reagent (TFTI), 98%, 98%, Trifluoromethylthio-iodine(III) reagent (TFTI), 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-acetyl-1-(trifluoromethylsulfanyl)-1lambda3,2-benziodazol-3-one (CAS 2242898-13-9) is a chemical compound with the molecular formula C10H7F3INO2S and a molecular weight of 389.13 g/mol. IUPAC name: 2-acetyl-1-(trifluoromethylsulfanyl)-1lambda3,2-benziodazol-3-one. InChIKey: VAJBRVJQMOSUHO-UHFFFAOYSA-N.
| Molecular formula | C10H7F3INO2S |
|---|---|
| Molecular weight | 389.13 g/mol |
| IUPAC name | 2-acetyl-1-(trifluoromethylsulfanyl)-1lambda3,2-benziodazol-3-one |
| InChIKey | VAJBRVJQMOSUHO-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C(=O)C2=CC=CC=C2I1SC(F)(F)F |
Computed by PubChem (NCBI)