CAS 22430-69-9 appears in our catalog under these names: D-Altronic acid lithium salt, 98%, D-Altronic acid lithium. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10mg, 5mg, 25mg, 100mg, 50mg.
Lithium 2,3,4,5,6-pentahydroxyhexanoate (CAS 22430-69-9) is a chemical compound with the molecular formula C6H11LiO7 and a molecular weight of 202.1 g/mol. IUPAC name: lithium 2,3,4,5,6-pentahydroxyhexanoate. InChIKey: ZOTSUVWAEYHZRI-UHFFFAOYSA-M.
| Molecular formula | C6H11LiO7 |
|---|---|
| Molecular weight | 202.1 g/mol |
| IUPAC name | lithium 2,3,4,5,6-pentahydroxyhexanoate |
| InChIKey | ZOTSUVWAEYHZRI-UHFFFAOYSA-M |
| SMILES | [Li+].C(C(C(C(C(C(=O)[O-])O)O)O)O)O |
Computed by PubChem (NCBI)