CAS 22432-68-4 appears in our catalog under these names: 4,4,5,5-Tetrachloro-1,3-dioxolan-2-one, 95%, 4,4,5,5-Tetrachloro-1,3-dioxolan-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 0,25g, 0,1g, 0,5g, 2g.
4,4,5,5-tetrachloro-1,3-dioxolan-2-one (CAS 22432-68-4) is a chemical compound with the molecular formula C3Cl4O3 and a molecular weight of 225.8 g/mol. IUPAC name: 4,4,5,5-tetrachloro-1,3-dioxolan-2-one. InChIKey: TXQPIYKVIOKFAB-UHFFFAOYSA-N.
| Molecular formula | C3Cl4O3 |
|---|---|
| Molecular weight | 225.8 g/mol |
| IUPAC name | 4,4,5,5-tetrachloro-1,3-dioxolan-2-one |
| InChIKey | TXQPIYKVIOKFAB-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(C(O1)(Cl)Cl)(Cl)Cl |
Computed by PubChem (NCBI)