Products 2243305-30-6
CAS 2243305-30-6 is the registry number for 2-(tert-butyl) 3-methyl (3S)-1-methyl-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indole-2,3-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-O-tert-butyl 3-O-methyl (3S)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2,3-dicarboxylate (CAS 2243305-30-6) is a chemical compound with the molecular formula C19H24N2O4 and a molecular weight of 344.4 g/mol. IUPAC name: 2-O-tert-butyl 3-O-methyl (3S)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2,3-dicarboxylate. InChIKey: WQQFMCUQQXFYQV-MHTVFEQDSA-N.
| Molecular formula | C19H24N2O4 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 2-O-tert-butyl 3-O-methyl (3S)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2,3-dicarboxylate |
| InChIKey | WQQFMCUQQXFYQV-MHTVFEQDSA-N |
| SMILES | CC1C2=C(C[C@H](N1C(=O)OC(C)(C)C)C(=O)OC)C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)