Products 67346-50-3
CAS 67346-50-3 appears in our catalog under these names: Formoterol EP Impurity I (S,R-Isomer) ((S,R)-Formoterol), (S,R)-Formoterol, Formoterol Impurity 19, (1S,2R)-Formoterol. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[2-hydroxy-5-[(1S)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]phenyl]formamide (CAS 67346-50-3) is a chemical compound with the molecular formula C19H24N2O4 and a molecular weight of 344.4 g/mol. IUPAC name: N-[2-hydroxy-5-[(1S)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]phenyl]formamide. InChIKey: BPZSYCZIITTYBL-BFUOFWGJSA-N.
| Molecular formula | C19H24N2O4 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | N-[2-hydroxy-5-[(1S)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]phenyl]formamide |
| InChIKey | BPZSYCZIITTYBL-BFUOFWGJSA-N |
| SMILES | C[C@H](CC1=CC=C(C=C1)OC)NC[C@H](C2=CC(=C(C=C2)O)NC=O)O |
Computed by PubChem (NCBI)