CAS 2243410-18-4 is the registry number for N-Methyl-1,1-bis(4-(trifluoromethyl)phenyl)methanamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
N-methyl-1,1-bis[4-(trifluoromethyl)phenyl]methanamine (CAS 2243410-18-4) is a chemical compound with the molecular formula C16H13F6N and a molecular weight of 333.27 g/mol. IUPAC name: N-methyl-1,1-bis[4-(trifluoromethyl)phenyl]methanamine. InChIKey: YXMKEGOFBPLKTM-UHFFFAOYSA-N.
| Molecular formula | C16H13F6N |
|---|---|
| Molecular weight | 333.27 g/mol |
| IUPAC name | N-methyl-1,1-bis[4-(trifluoromethyl)phenyl]methanamine |
| InChIKey | YXMKEGOFBPLKTM-UHFFFAOYSA-N |
| SMILES | CNC(C1=CC=C(C=C1)C(F)(F)F)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)