CAS 2243501-42-8 is the registry number for (4R)-3,4-Dihydro-2H-1-benzopyran-4,6-diol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4R)-3,4-dihydro-2H-chromene-4,6-diol (CAS 2243501-42-8) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 166.17 g/mol. IUPAC name: (4R)-3,4-dihydro-2H-chromene-4,6-diol. InChIKey: DEIXNYIUQLLDBS-MRVPVSSYSA-N.
| Molecular formula | C9H10O3 |
|---|---|
| Molecular weight | 166.17 g/mol |
| IUPAC name | (4R)-3,4-dihydro-2H-chromene-4,6-diol |
| InChIKey | DEIXNYIUQLLDBS-MRVPVSSYSA-N |
| SMILES | C1COC2=C([C@@H]1O)C=C(C=C2)O |
Computed by PubChem (NCBI)